C15H22N2O2 — CID 64972432
3-cyclopropyl-6-ethyl-3-methyl-1-(2-methylbut-3-yn-2-yl)piperazine-2,5-dione (PubChem CID 64972432) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 3-cyclopropyl-6-ethyl-3-methyl-1-(2-methylbut-3-yn-2-yl)piperazine-2,5-dione.
| Compound Name | 3-cyclopropyl-6-ethyl-3-methyl-1-(2-methylbut-3-yn-2-yl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64972432 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 3-cyclopropyl-6-ethyl-3-methyl-1-(2-methylbut-3-yn-2-yl)piperazine-2,5-dione |
| SMILES | C#CC(C)(C)N1C(=O)C(C)(C2CC2)NC(=O)C1CC |
| InChI | InChI=1S/C15H22N2O2/c1-6-11-12(18)16-15(5,10-8-9-10)13(19)17(11)14(3,4)7-2/h2,10-11H,6,8-9H2,1,3-5H3,(H,16,18) |
| InChIKey | XDXYKZALCRZIKM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|