C12H16N4O — CID 64974387
1-(4,5-dimethyl-1,2,4-triazol-3-yl)-N-phenylmethoxymethanamine (PubChem CID 64974387) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is 1-(4,5-dimethyl-1,2,4-triazol-3-yl)-N-phenylmethoxymethanamine.
| Compound Name | 1-(4,5-dimethyl-1,2,4-triazol-3-yl)-N-phenylmethoxymethanamine |
|---|---|
| PubChem CID | 64974387 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 1-(4,5-dimethyl-1,2,4-triazol-3-yl)-N-phenylmethoxymethanamine |
| SMILES | Cc1nnc(CNOCc2ccccc2)n1C |
| InChI | InChI=1S/C12H16N4O/c1-10-14-15-12(16(10)2)8-13-17-9-11-6-4-3-5-7-11/h3-7,13H,8-9H2,1-2H3 |
| InChIKey | LXUZCOJXWBTNOE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|