About 2-(4-methoxyphenyl)-6,7-dihydro-5H-1,3-benzothiazol-4-one
2-(4-methoxyphenyl)-6,7-dihydro-5H-1,3-benzothiazol-4-one (PubChem CID 64975135) has the molecular formula C14H13NO2S
and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-6,7-dihydro-5H-1,3-benzothiazol-4-one.
Molecular Properties
| Compound Name | 2-(4-methoxyphenyl)-6,7-dihydro-5H-1,3-benzothiazol-4-one |
| PubChem CID | 64975135 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-(4-methoxyphenyl)-6,7-dihydro-5H-1,3-benzothiazol-4-one |
| SMILES | COc1ccc(-c2nc3c(s2)CCCC3=O)cc1 |
| InChI | InChI=1S/C14H13NO2S/c1-17-10-7-5-9(6-8-10)14-15-13-11(16)3-2-4-12(13)18-14/h5-8H,2-4H2,1H3 |
| InChIKey | GTMYYOWTNXCRLF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-methoxyphenyl)-6,7-dihydro-5H-1,3-benzothiazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxyphenyl)-6,7-dihydro-5H-1,3-benzothiazol-4-one?
The IUPAC name of 2-(4-methoxyphenyl)-6,7-dihydro-5H-1,3-benzothiazol-4-one (CID 64975135) is 2-(4-methoxyphenyl)-6,7-dihydro-5H-1,3-benzothiazol-4-one.
What is the SMILES notation for 2-(4-methoxyphenyl)-6,7-dihydro-5H-1,3-benzothiazol-4-one?
The canonical SMILES for 2-(4-methoxyphenyl)-6,7-dihydro-5H-1,3-benzothiazol-4-one is COc1ccc(-c2nc3c(s2)CCCC3=O)cc1.
What is the InChIKey of 2-(4-methoxyphenyl)-6,7-dihydro-5H-1,3-benzothiazol-4-one?
The InChIKey is GTMYYOWTNXCRLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2S/c1-17-10-7-5-9(6-8-10)14-15-13-11(16)3-2-4-12(13)18-14/h5-8H,2-4H2,1H3.
What are the key properties of 2-(4-methoxyphenyl)-6,7-dihydro-5H-1,3-benzothiazol-4-one?
2-(4-methoxyphenyl)-6,7-dihydro-5H-1,3-benzothiazol-4-one has a molecular weight of 259.33 g/mol, XLogP of 3.34, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyphenyl)-6,7-dihydro-5H-1,3-benzothiazol-4-one is sourced from PubChem (CID 64975135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).