C10H13N5S — CID 64975493
N-methyl-2-(1H-1,2,4-triazol-5-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine (PubChem CID 64975493) has the molecular formula C10H13N5S and a molecular weight of 235.32 g/mol. Its IUPAC name is N-methyl-2-(1H-1,2,4-triazol-5-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine.
| Compound Name | N-methyl-2-(1H-1,2,4-triazol-5-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine |
|---|---|
| PubChem CID | 64975493 |
| Molecular Formula | C10H13N5S |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | N-methyl-2-(1H-1,2,4-triazol-5-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine |
| SMILES | CNC1CCCc2sc(-c3ncn[nH]3)nc21 |
| InChI | InChI=1S/C10H13N5S/c1-11-6-3-2-4-7-8(6)14-10(16-7)9-12-5-13-15-9/h5-6,11H,2-4H2,1H3,(H,12,13,15) |
| InChIKey | IPQYTSWFVXAXDI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |