About 2-(5-methylfuran-2-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-one
2-(5-methylfuran-2-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-one (PubChem CID 64975790) has the molecular formula C12H11NO2S
and a molecular weight of 233.29 g/mol. Its IUPAC name is 2-(5-methylfuran-2-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-one.
Molecular Properties
| Compound Name | 2-(5-methylfuran-2-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-one |
| PubChem CID | 64975790 |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 2-(5-methylfuran-2-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-one |
| SMILES | Cc1ccc(-c2nc3c(s2)CCCC3=O)o1 |
| InChI | InChI=1S/C12H11NO2S/c1-7-5-6-9(15-7)12-13-11-8(14)3-2-4-10(11)16-12/h5-6H,2-4H2,1H3 |
| InChIKey | JMHJYBWSFGXOMF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-methylfuran-2-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methylfuran-2-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-one?
The IUPAC name of 2-(5-methylfuran-2-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-one (CID 64975790) is 2-(5-methylfuran-2-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-one.
What is the SMILES notation for 2-(5-methylfuran-2-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-one?
The canonical SMILES for 2-(5-methylfuran-2-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-one is Cc1ccc(-c2nc3c(s2)CCCC3=O)o1.
What is the InChIKey of 2-(5-methylfuran-2-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-one?
The InChIKey is JMHJYBWSFGXOMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2S/c1-7-5-6-9(15-7)12-13-11-8(14)3-2-4-10(11)16-12/h5-6H,2-4H2,1H3.
What are the key properties of 2-(5-methylfuran-2-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-one?
2-(5-methylfuran-2-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-one has a molecular weight of 233.29 g/mol, XLogP of 3.23, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methylfuran-2-yl)-6,7-dihydro-5H-1,3-benzothiazol-4-one is sourced from PubChem (CID 64975790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).