C9H10F3NOS — CID 64976350
2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol (PubChem CID 64976350) has the molecular formula C9H10F3NOS and a molecular weight of 237.25 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol.
| Compound Name | 2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol |
|---|---|
| PubChem CID | 64976350 |
| Molecular Formula | C9H10F3NOS |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol |
| SMILES | OC1CCCc2sc(CC(F)(F)F)nc21 |
| InChI | InChI=1S/C9H10F3NOS/c10-9(11,12)4-7-13-8-5(14)2-1-3-6(8)15-7/h5,14H,1-4H2 |
| InChIKey | SIDCUVFZVVRXAN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |