C14H25N3S — CID 64977023
2-N,4-N-dimethyl-2-N-(3-methylbutyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine (PubChem CID 64977023) has the molecular formula C14H25N3S and a molecular weight of 267.44 g/mol. Its IUPAC name is 2-N,4-N-dimethyl-2-N-(3-methylbutyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine.
| Compound Name | 2-N,4-N-dimethyl-2-N-(3-methylbutyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine |
|---|---|
| PubChem CID | 64977023 |
| Molecular Formula | C14H25N3S |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 2-N,4-N-dimethyl-2-N-(3-methylbutyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine |
| SMILES | CNC1CCCc2sc(N(C)CCC(C)C)nc21 |
| InChI | InChI=1S/C14H25N3S/c1-10(2)8-9-17(4)14-16-13-11(15-3)6-5-7-12(13)18-14/h10-11,15H,5-9H2,1-4H3 |
| InChIKey | QGZYDGKDTZOIOY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |