C16H20ClN3S — CID 64977143
2-N-[(2-chlorophenyl)methyl]-2-N,4-N-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine (PubChem CID 64977143) has the molecular formula C16H20ClN3S and a molecular weight of 321.88 g/mol. Its IUPAC name is 2-N-[(2-chlorophenyl)methyl]-2-N,4-N-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine.
| Compound Name | 2-N-[(2-chlorophenyl)methyl]-2-N,4-N-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine |
|---|---|
| PubChem CID | 64977143 |
| Molecular Formula | C16H20ClN3S |
| Molecular Weight | 321.88 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-N-[(2-chlorophenyl)methyl]-2-N,4-N-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine |
| SMILES | CNC1CCCc2sc(N(C)Cc3ccccc3Cl)nc21 |
| InChI | InChI=1S/C16H20ClN3S/c1-18-13-8-5-9-14-15(13)19-16(21-14)20(2)10-11-6-3-4-7-12(11)17/h3-4,6-7,13,18H,5,8-10H2,1-2H3 |
| InChIKey | JYIKMLSDGLUKQC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.88 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |