C13H27N3 — CID 64977928
2,5-diethyl-1-(1-methylpyrrolidin-3-yl)piperazine (PubChem CID 64977928) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is 2,5-diethyl-1-(1-methylpyrrolidin-3-yl)piperazine.
| Compound Name | 2,5-diethyl-1-(1-methylpyrrolidin-3-yl)piperazine |
|---|---|
| PubChem CID | 64977928 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | 2,5-diethyl-1-(1-methylpyrrolidin-3-yl)piperazine |
| SMILES | CCC1CN(C2CCN(C)C2)C(CC)CN1 |
| InChI | InChI=1S/C13H27N3/c1-4-11-9-16(12(5-2)8-14-11)13-6-7-15(3)10-13/h11-14H,4-10H2,1-3H3 |
| InChIKey | SWENICJTCQUHMS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |