C23H29N7O2S2 — CID 6497825
2-[5-[2-[(5-cyclohexyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]-N-(3,4-dimethylphenyl)acetamide (PubChem CID 6497825) has the molecular formula C23H29N7O2S2 and a molecular weight of 499.67 g/mol. Its IUPAC name is 2-[5-[2-[(5-cyclohexyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-[5-[2-[(5-cyclohexyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 6497825 |
| Molecular Formula | C23H29N7O2S2 |
| Molecular Weight | 499.67 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 2-[5-[2-[(5-cyclohexyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]-N-(3,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cc2nnc(SCC(=O)Nc3nnc(C4CCCCC4)s3)n2C)cc1C |
| InChI | InChI=1S/C23H29N7O2S2/c1-14-9-10-17(11-15(14)2)24-19(31)12-18-26-29-23(30(18)3)33-13-20(32)25-22-28-27-21(34-22)16-7-5-4-6-8-16/h9-11,16H,4-8,12-13H2,1-3H3,(H,24,31)(H,25,28,32) |
| InChIKey | WFZRDLSGANOGLW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.67 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |