About 2-(2,5-diethylpiperazin-1-yl)-N-(3-ethylpent-1-yn-3-yl)acetamide
2-(2,5-diethylpiperazin-1-yl)-N-(3-ethylpent-1-yn-3-yl)acetamide (PubChem CID 64979190) has the molecular formula C17H31N3O
and a molecular weight of 293.45 g/mol. Its IUPAC name is 2-(2,5-diethylpiperazin-1-yl)-N-(3-ethylpent-1-yn-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-(2,5-diethylpiperazin-1-yl)-N-(3-ethylpent-1-yn-3-yl)acetamide |
| PubChem CID | 64979190 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | 2-(2,5-diethylpiperazin-1-yl)-N-(3-ethylpent-1-yn-3-yl)acetamide |
| SMILES | C#CC(CC)(CC)NC(=O)CN1CC(CC)NCC1CC |
| InChI | InChI=1S/C17H31N3O/c1-6-14-12-20(15(7-2)11-18-14)13-16(21)19-17(8-3,9-4)10-5/h3,14-15,18H,6-7,9-13H2,1-2,4-5H3,(H,19,21) |
| InChIKey | QPFVQTDDCVETSG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-diethylpiperazin-1-yl)-N-(3-ethylpent-1-yn-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-diethylpiperazin-1-yl)-N-(3-ethylpent-1-yn-3-yl)acetamide?
The IUPAC name of 2-(2,5-diethylpiperazin-1-yl)-N-(3-ethylpent-1-yn-3-yl)acetamide (CID 64979190) is 2-(2,5-diethylpiperazin-1-yl)-N-(3-ethylpent-1-yn-3-yl)acetamide.
What is the SMILES notation for 2-(2,5-diethylpiperazin-1-yl)-N-(3-ethylpent-1-yn-3-yl)acetamide?
The canonical SMILES for 2-(2,5-diethylpiperazin-1-yl)-N-(3-ethylpent-1-yn-3-yl)acetamide is C#CC(CC)(CC)NC(=O)CN1CC(CC)NCC1CC.
What is the InChIKey of 2-(2,5-diethylpiperazin-1-yl)-N-(3-ethylpent-1-yn-3-yl)acetamide?
The InChIKey is QPFVQTDDCVETSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31N3O/c1-6-14-12-20(15(7-2)11-18-14)13-16(21)19-17(8-3,9-4)10-5/h3,14-15,18H,6-7,9-13H2,1-2,4-5H3,(H,19,21).
What are the key properties of 2-(2,5-diethylpiperazin-1-yl)-N-(3-ethylpent-1-yn-3-yl)acetamide?
2-(2,5-diethylpiperazin-1-yl)-N-(3-ethylpent-1-yn-3-yl)acetamide has a molecular weight of 293.45 g/mol, XLogP of 1.76, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-diethylpiperazin-1-yl)-N-(3-ethylpent-1-yn-3-yl)acetamide is sourced from PubChem (CID 64979190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).