C9H16N2O — CID 64979937
1-(2,5-dimethylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 64979937) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-(2,5-dimethylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | 1-(2,5-dimethylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 64979937 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 1-(2,5-dimethylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(C)NCC1C |
| InChI | InChI=1S/C9H16N2O/c1-4-9(12)11-6-7(2)10-5-8(11)3/h4,7-8,10H,1,5-6H2,2-3H3 |
| InChIKey | GBQUXCUNKXKAOH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|