C4H6O2S — CID 6498
2,5-dihydrothiophene 1,1-dioxide (PubChem CID 6498) has the molecular formula C4H6O2S and a molecular weight of 118.16 g/mol. Its IUPAC name is 2,5-dihydrothiophene 1,1-dioxide.
| Compound Name | 2,5-dihydrothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 6498 |
| Molecular Formula | C4H6O2S |
| Molecular Weight | 118.16 g/mol |
| Exact Mass | 118.01 |
| IUPAC Name | 2,5-dihydrothiophene 1,1-dioxide |
| SMILES | O=S1(=O)CC=CC1 |
| InChI | InChI=1S/C4H6O2S/c5-7(6)3-1-2-4-7/h1-2H,3-4H2 |
| InChIKey | MBDNRNMVTZADMQ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.16 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|