C14H23N3OS — CID 64980594
2-(2,5-dimethylpiperazin-1-yl)-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 64980594) has the molecular formula C14H23N3OS and a molecular weight of 281.42 g/mol. Its IUPAC name is 2-(2,5-dimethylpiperazin-1-yl)-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-(2,5-dimethylpiperazin-1-yl)-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 64980594 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-(2,5-dimethylpiperazin-1-yl)-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | CC1CN(CC(=O)NCCc2cccs2)C(C)CN1 |
| InChI | InChI=1S/C14H23N3OS/c1-11-9-17(12(2)8-16-11)10-14(18)15-6-5-13-4-3-7-19-13/h3-4,7,11-12,16H,5-6,8-10H2,1-2H3,(H,15,18) |
| InChIKey | FYFVVEPTOZNHJZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |