About hydron;1-[4-(2-hydroxy-3-phenoxypropyl)piperazin-1-yl]-2-phenoxyethanone;chloride
hydron;1-[4-(2-hydroxy-3-phenoxypropyl)piperazin-1-yl]-2-phenoxyethanone;chloride (PubChem CID 649806) has the molecular formula C21H27ClN2O4
and a molecular weight of 406.91 g/mol. Its IUPAC name is hydron;1-[4-(2-hydroxy-3-phenoxypropyl)piperazin-1-yl]-2-phenoxyethanone;chloride.
Molecular Properties
| Compound Name | hydron;1-[4-(2-hydroxy-3-phenoxypropyl)piperazin-1-yl]-2-phenoxyethanone;chloride |
| PubChem CID | 649806 |
| Molecular Formula | C21H27ClN2O4 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | hydron;1-[4-(2-hydroxy-3-phenoxypropyl)piperazin-1-yl]-2-phenoxyethanone;chloride |
| SMILES | O=C(COc1ccccc1)N1CCN(CC(O)COc2ccccc2)CC1.[Cl-].[H+] |
| InChI | InChI=1S/C21H26N2O4.ClH/c24-18(16-26-19-7-3-1-4-8-19)15-22-11-13-23(14-12-22)21(25)17-27-20-9-5-2-6-10-20;/h1-10,18,24H,11-17H2;1H |
| InChIKey | MYCRKKBBICIIHK-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze hydron;1-[4-(2-hydroxy-3-phenoxypropyl)piperazin-1-yl]-2-phenoxyethanone;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;1-[4-(2-hydroxy-3-phenoxypropyl)piperazin-1-yl]-2-phenoxyethanone;chloride?
The IUPAC name of hydron;1-[4-(2-hydroxy-3-phenoxypropyl)piperazin-1-yl]-2-phenoxyethanone;chloride (CID 649806) is hydron;1-[4-(2-hydroxy-3-phenoxypropyl)piperazin-1-yl]-2-phenoxyethanone;chloride.
What is the SMILES notation for hydron;1-[4-(2-hydroxy-3-phenoxypropyl)piperazin-1-yl]-2-phenoxyethanone;chloride?
The canonical SMILES for hydron;1-[4-(2-hydroxy-3-phenoxypropyl)piperazin-1-yl]-2-phenoxyethanone;chloride is O=C(COc1ccccc1)N1CCN(CC(O)COc2ccccc2)CC1.[Cl-].[H+].
What is the InChIKey of hydron;1-[4-(2-hydroxy-3-phenoxypropyl)piperazin-1-yl]-2-phenoxyethanone;chloride?
The InChIKey is MYCRKKBBICIIHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O4.ClH/c24-18(16-26-19-7-3-1-4-8-19)15-22-11-13-23(14-12-22)21(25)17-27-20-9-5-2-6-10-20;/h1-10,18,24H,11-17H2;1H.
What are the key properties of hydron;1-[4-(2-hydroxy-3-phenoxypropyl)piperazin-1-yl]-2-phenoxyethanone;chloride?
hydron;1-[4-(2-hydroxy-3-phenoxypropyl)piperazin-1-yl]-2-phenoxyethanone;chloride has a molecular weight of 406.91 g/mol, XLogP of -1.23, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;1-[4-(2-hydroxy-3-phenoxypropyl)piperazin-1-yl]-2-phenoxyethanone;chloride is sourced from PubChem (CID 649806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).