About 1-amino-4-ethyl-N'-hydroxycyclohexane-1-carboximidamide
1-amino-4-ethyl-N'-hydroxycyclohexane-1-carboximidamide (PubChem CID 64980904) has the molecular formula C9H19N3O
and a molecular weight of 185.27 g/mol. Its IUPAC name is 1-amino-4-ethyl-N'-hydroxycyclohexane-1-carboximidamide.
Molecular Properties
| Compound Name | 1-amino-4-ethyl-N'-hydroxycyclohexane-1-carboximidamide |
| PubChem CID | 64980904 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 1-amino-4-ethyl-N'-hydroxycyclohexane-1-carboximidamide |
| SMILES | CCC1CCC(N)(/C(N)=N/O)CC1 |
| InChI | InChI=1S/C9H19N3O/c1-2-7-3-5-9(11,6-4-7)8(10)12-13/h7,13H,2-6,11H2,1H3,(H2,10,12) |
| InChIKey | PMFGIWRIJOZKBV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-4-ethyl-N'-hydroxycyclohexane-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-4-ethyl-N'-hydroxycyclohexane-1-carboximidamide?
The IUPAC name of 1-amino-4-ethyl-N'-hydroxycyclohexane-1-carboximidamide (CID 64980904) is 1-amino-4-ethyl-N'-hydroxycyclohexane-1-carboximidamide.
What is the SMILES notation for 1-amino-4-ethyl-N'-hydroxycyclohexane-1-carboximidamide?
The canonical SMILES for 1-amino-4-ethyl-N'-hydroxycyclohexane-1-carboximidamide is CCC1CCC(N)(/C(N)=N/O)CC1.
What is the InChIKey of 1-amino-4-ethyl-N'-hydroxycyclohexane-1-carboximidamide?
The InChIKey is PMFGIWRIJOZKBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O/c1-2-7-3-5-9(11,6-4-7)8(10)12-13/h7,13H,2-6,11H2,1H3,(H2,10,12).
What are the key properties of 1-amino-4-ethyl-N'-hydroxycyclohexane-1-carboximidamide?
1-amino-4-ethyl-N'-hydroxycyclohexane-1-carboximidamide has a molecular weight of 185.27 g/mol, XLogP of 1.03, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-4-ethyl-N'-hydroxycyclohexane-1-carboximidamide is sourced from PubChem (CID 64980904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).