C11H6Br2F5N3 — CID 64980921
6,8-dibromo-N-methyl-2-(1,1,2,2,2-pentafluoroethyl)quinazolin-4-amine (PubChem CID 64980921) has the molecular formula C11H6Br2F5N3 and a molecular weight of 434.99 g/mol. Its IUPAC name is 6,8-dibromo-N-methyl-2-(1,1,2,2,2-pentafluoroethyl)quinazolin-4-amine.
| Compound Name | 6,8-dibromo-N-methyl-2-(1,1,2,2,2-pentafluoroethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 64980921 |
| Molecular Formula | C11H6Br2F5N3 |
| Molecular Weight | 434.99 g/mol |
| Exact Mass | 432.88 |
| IUPAC Name | 6,8-dibromo-N-methyl-2-(1,1,2,2,2-pentafluoroethyl)quinazolin-4-amine |
| SMILES | CNc1nc(C(F)(F)C(F)(F)F)nc2c(Br)cc(Br)cc12 |
| InChI | InChI=1S/C11H6Br2F5N3/c1-19-8-5-2-4(12)3-6(13)7(5)20-9(21-8)10(14,15)11(16,17)18/h2-3H,1H3,(H,19,20,21) |
| InChIKey | ZYJQSPPFEJRWRX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.99 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|