C9H7FN2O — CID 64981556
4-(4-fluorophenyl)-1,2-oxazol-3-amine (PubChem CID 64981556) has the molecular formula C9H7FN2O and a molecular weight of 178.17 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1,2-oxazol-3-amine.
| Compound Name | 4-(4-fluorophenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 64981556 |
| Molecular Formula | C9H7FN2O |
| Molecular Weight | 178.17 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 4-(4-fluorophenyl)-1,2-oxazol-3-amine |
| SMILES | Nc1nocc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C9H7FN2O/c10-7-3-1-6(2-4-7)8-5-13-12-9(8)11/h1-5H,(H2,11,12) |
| InChIKey | XHCAZTYYUSFLPZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.17 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |