About 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylic acid
2-(oxolan-2-yl)-1,3-thiazole-5-carboxylic acid (PubChem CID 64981658) has the molecular formula C8H9NO3S
and a molecular weight of 199.23 g/mol. Its IUPAC name is 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 64981658 |
| Molecular Formula | C8H9NO3S |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.03 |
| IUPAC Name | 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(C2CCCO2)s1 |
| InChI | InChI=1S/C8H9NO3S/c10-8(11)6-4-9-7(13-6)5-2-1-3-12-5/h4-5H,1-3H2,(H,10,11) |
| InChIKey | MEPUJIXKIDJYNN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylic acid (CID 64981658) is 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylic acid is O=C(O)c1cnc(C2CCCO2)s1.
What is the InChIKey of 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is MEPUJIXKIDJYNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3S/c10-8(11)6-4-9-7(13-6)5-2-1-3-12-5/h4-5H,1-3H2,(H,10,11).
What are the key properties of 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylic acid?
2-(oxolan-2-yl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 199.23 g/mol, XLogP of 1.69, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxolan-2-yl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 64981658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).