About ethyl 4-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]piperazine-1-carboxylate
ethyl 4-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]piperazine-1-carboxylate (PubChem CID 6498214) has the molecular formula C12H18N4O3S
and a molecular weight of 298.37 g/mol. Its IUPAC name is ethyl 4-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]piperazine-1-carboxylate |
| PubChem CID | 6498214 |
| Molecular Formula | C12H18N4O3S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | ethyl 4-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CC(=O)Nc2nccs2)CC1 |
| InChI | InChI=1S/C12H18N4O3S/c1-2-19-12(18)16-6-4-15(5-7-16)9-10(17)14-11-13-3-8-20-11/h3,8H,2,4-7,9H2,1H3,(H,13,14,17) |
| InChIKey | GUCKNBHMIPAVSK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]piperazine-1-carboxylate?
The IUPAC name of ethyl 4-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]piperazine-1-carboxylate (CID 6498214) is ethyl 4-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]piperazine-1-carboxylate is CCOC(=O)N1CCN(CC(=O)Nc2nccs2)CC1.
What is the InChIKey of ethyl 4-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]piperazine-1-carboxylate?
The InChIKey is GUCKNBHMIPAVSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O3S/c1-2-19-12(18)16-6-4-15(5-7-16)9-10(17)14-11-13-3-8-20-11/h3,8H,2,4-7,9H2,1H3,(H,13,14,17).
What are the key properties of ethyl 4-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]piperazine-1-carboxylate?
ethyl 4-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]piperazine-1-carboxylate has a molecular weight of 298.37 g/mol, XLogP of 0.86, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]piperazine-1-carboxylate is sourced from PubChem (CID 6498214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).