C11H17N3O — CID 64982229
3-cyclobutyl-5-piperidin-2-yl-1,2,4-oxadiazole (PubChem CID 64982229) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 3-cyclobutyl-5-piperidin-2-yl-1,2,4-oxadiazole.
| Compound Name | 3-cyclobutyl-5-piperidin-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 64982229 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 3-cyclobutyl-5-piperidin-2-yl-1,2,4-oxadiazole |
| SMILES | C1CCC(c2nc(C3CCC3)no2)NC1 |
| InChI | InChI=1S/C11H17N3O/c1-2-7-12-9(6-1)11-13-10(14-15-11)8-4-3-5-8/h8-9,12H,1-7H2 |
| InChIKey | ZFPVBLUCIBUVRG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |