C11H24N2O2S — CID 649823
N-(1,1-dioxothiolan-3-yl)-N',N'-diethylpropane-1,3-diamine (PubChem CID 649823) has the molecular formula C11H24N2O2S and a molecular weight of 248.39 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 649823 |
| Molecular Formula | C11H24N2O2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H24N2O2S/c1-3-13(4-2)8-5-7-12-11-6-9-16(14,15)10-11/h11-12H,3-10H2,1-2H3 |
| InChIKey | SPLKEQUSHJHMGF-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|