2-cyclobutyl-1,3-thiazole-5-carboxylic acid

C8H9NO2S — CID 64982499

IUPAC2-cyclobutyl-1,3-thiazole-5-carboxylic acid
SMILESO=C(O)c1cnc(C2CCC2)s1
InChIInChI=1S/C8H9NO2S/c10-8(11)6-4-9-7(12-6)5-2-1-3-5/h4-5H,1-3H2,(H,10,11)
InChIKeyRKQVMDFILOTXAY-UHFFFAOYSA-N
MW183.23 g/mol
LogP2.11
Rot. Bonds2

About 2-cyclobutyl-1,3-thiazole-5-carboxylic acid

2-cyclobutyl-1,3-thiazole-5-carboxylic acid (PubChem CID 64982499) has the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. Its IUPAC name is 2-cyclobutyl-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-cyclobutyl-1,3-thiazole-5-carboxylic acid
PubChem CID64982499
Molecular FormulaC8H9NO2S
Molecular Weight183.23 g/mol
Exact Mass183.04
IUPAC Name2-cyclobutyl-1,3-thiazole-5-carboxylic acid
SMILESO=C(O)c1cnc(C2CCC2)s1
InChIInChI=1S/C8H9NO2S/c10-8(11)6-4-9-7(12-6)5-2-1-3-5/h4-5H,1-3H2,(H,10,11)
InChIKeyRKQVMDFILOTXAY-UHFFFAOYSA-N
XLogP2.11
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.23
LogP ≤ 52.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-cyclobutyl-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyclobutyl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-cyclobutyl-1,3-thiazole-5-carboxylic acid (CID 64982499) is 2-cyclobutyl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-cyclobutyl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-cyclobutyl-1,3-thiazole-5-carboxylic acid is O=C(O)c1cnc(C2CCC2)s1.
What is the InChIKey of 2-cyclobutyl-1,3-thiazole-5-carboxylic acid?
The InChIKey is RKQVMDFILOTXAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2S/c10-8(11)6-4-9-7(12-6)5-2-1-3-5/h4-5H,1-3H2,(H,10,11).
What are the key properties of 2-cyclobutyl-1,3-thiazole-5-carboxylic acid?
2-cyclobutyl-1,3-thiazole-5-carboxylic acid has a molecular weight of 183.23 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutyl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 64982499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).