About propan-2-yl thiolane-2-carboxylate
propan-2-yl thiolane-2-carboxylate (PubChem CID 64982692) has the molecular formula C8H14O2S
and a molecular weight of 174.26 g/mol. Its IUPAC name is propan-2-yl thiolane-2-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl thiolane-2-carboxylate |
| PubChem CID | 64982692 |
| Molecular Formula | C8H14O2S |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | propan-2-yl thiolane-2-carboxylate |
| SMILES | CC(C)OC(=O)C1CCCS1 |
| InChI | InChI=1S/C8H14O2S/c1-6(2)10-8(9)7-4-3-5-11-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | QJWMTGDHOAQAQZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl thiolane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl thiolane-2-carboxylate?
The IUPAC name of propan-2-yl thiolane-2-carboxylate (CID 64982692) is propan-2-yl thiolane-2-carboxylate.
What is the SMILES notation for propan-2-yl thiolane-2-carboxylate?
The canonical SMILES for propan-2-yl thiolane-2-carboxylate is CC(C)OC(=O)C1CCCS1.
What is the InChIKey of propan-2-yl thiolane-2-carboxylate?
The InChIKey is QJWMTGDHOAQAQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2S/c1-6(2)10-8(9)7-4-3-5-11-7/h6-7H,3-5H2,1-2H3.
What are the key properties of propan-2-yl thiolane-2-carboxylate?
propan-2-yl thiolane-2-carboxylate has a molecular weight of 174.26 g/mol, XLogP of 1.83, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl thiolane-2-carboxylate is sourced from PubChem (CID 64982692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).