About 2-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine
2-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine (PubChem CID 64982952) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is 2-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine |
| PubChem CID | 64982952 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 2-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine |
| SMILES | NCCc1nnc(-c2ccco2)s1 |
| InChI | InChI=1S/C8H9N3OS/c9-4-3-7-10-11-8(13-7)6-2-1-5-12-6/h1-2,5H,3-4,9H2 |
| InChIKey | SWJYUECKRYPYKK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine?
The IUPAC name of 2-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine (CID 64982952) is 2-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine.
What is the SMILES notation for 2-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine?
The canonical SMILES for 2-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine is NCCc1nnc(-c2ccco2)s1.
What is the InChIKey of 2-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine?
The InChIKey is SWJYUECKRYPYKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c9-4-3-7-10-11-8(13-7)6-2-1-5-12-6/h1-2,5H,3-4,9H2.
What are the key properties of 2-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine?
2-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine has a molecular weight of 195.25 g/mol, XLogP of 1.30, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(furan-2-yl)-1,3,4-thiadiazol-2-yl]ethanamine is sourced from PubChem (CID 64982952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).