About 6,8-dibromo-2-(3,5-difluorophenyl)quinazolin-4-amine
6,8-dibromo-2-(3,5-difluorophenyl)quinazolin-4-amine (PubChem CID 64983350) has the molecular formula C14H7Br2F2N3
and a molecular weight of 415.04 g/mol. Its IUPAC name is 6,8-dibromo-2-(3,5-difluorophenyl)quinazolin-4-amine.
Molecular Properties
| Compound Name | 6,8-dibromo-2-(3,5-difluorophenyl)quinazolin-4-amine |
| PubChem CID | 64983350 |
| Molecular Formula | C14H7Br2F2N3 |
| Molecular Weight | 415.04 g/mol |
| Exact Mass | 412.90 |
| IUPAC Name | 6,8-dibromo-2-(3,5-difluorophenyl)quinazolin-4-amine |
| SMILES | Nc1nc(-c2cc(F)cc(F)c2)nc2c(Br)cc(Br)cc12 |
| InChI | InChI=1S/C14H7Br2F2N3/c15-7-3-10-12(11(16)4-7)20-14(21-13(10)19)6-1-8(17)5-9(18)2-6/h1-5H,(H2,19,20,21) |
| InChIKey | NAJDTFRGKIODFW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.04 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,8-dibromo-2-(3,5-difluorophenyl)quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dibromo-2-(3,5-difluorophenyl)quinazolin-4-amine?
The IUPAC name of 6,8-dibromo-2-(3,5-difluorophenyl)quinazolin-4-amine (CID 64983350) is 6,8-dibromo-2-(3,5-difluorophenyl)quinazolin-4-amine.
What is the SMILES notation for 6,8-dibromo-2-(3,5-difluorophenyl)quinazolin-4-amine?
The canonical SMILES for 6,8-dibromo-2-(3,5-difluorophenyl)quinazolin-4-amine is Nc1nc(-c2cc(F)cc(F)c2)nc2c(Br)cc(Br)cc12.
What is the InChIKey of 6,8-dibromo-2-(3,5-difluorophenyl)quinazolin-4-amine?
The InChIKey is NAJDTFRGKIODFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7Br2F2N3/c15-7-3-10-12(11(16)4-7)20-14(21-13(10)19)6-1-8(17)5-9(18)2-6/h1-5H,(H2,19,20,21).
What are the key properties of 6,8-dibromo-2-(3,5-difluorophenyl)quinazolin-4-amine?
6,8-dibromo-2-(3,5-difluorophenyl)quinazolin-4-amine has a molecular weight of 415.04 g/mol, XLogP of 4.68, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dibromo-2-(3,5-difluorophenyl)quinazolin-4-amine is sourced from PubChem (CID 64983350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).