C12H15F2N3O2 — CID 64983469
1-(2,3-difluoro-6-nitrophenyl)-2,5-dimethylpiperazine (PubChem CID 64983469) has the molecular formula C12H15F2N3O2 and a molecular weight of 271.27 g/mol. Its IUPAC name is 1-(2,3-difluoro-6-nitrophenyl)-2,5-dimethylpiperazine.
| Compound Name | 1-(2,3-difluoro-6-nitrophenyl)-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 64983469 |
| Molecular Formula | C12H15F2N3O2 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 1-(2,3-difluoro-6-nitrophenyl)-2,5-dimethylpiperazine |
| SMILES | CC1CN(c2c([N+](=O)[O-])ccc(F)c2F)C(C)CN1 |
| InChI | InChI=1S/C12H15F2N3O2/c1-7-6-16(8(2)5-15-7)12-10(17(18)19)4-3-9(13)11(12)14/h3-4,7-8,15H,5-6H2,1-2H3 |
| InChIKey | SVOVGHTWPMXRSH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|