C10H5ClF5N3 — CID 64983527
6-chloro-2-(1,1,2,2,2-pentafluoroethyl)quinazolin-4-amine (PubChem CID 64983527) has the molecular formula C10H5ClF5N3 and a molecular weight of 297.61 g/mol. Its IUPAC name is 6-chloro-2-(1,1,2,2,2-pentafluoroethyl)quinazolin-4-amine.
| Compound Name | 6-chloro-2-(1,1,2,2,2-pentafluoroethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 64983527 |
| Molecular Formula | C10H5ClF5N3 |
| Molecular Weight | 297.61 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 6-chloro-2-(1,1,2,2,2-pentafluoroethyl)quinazolin-4-amine |
| SMILES | Nc1nc(C(F)(F)C(F)(F)F)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C10H5ClF5N3/c11-4-1-2-6-5(3-4)7(17)19-8(18-6)9(12,13)10(14,15)16/h1-3H,(H2,17,18,19) |
| InChIKey | LYEREMVDWNSAFT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.61 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|