C11H8F5N3 — CID 64983638
8-methyl-2-(1,1,2,2,2-pentafluoroethyl)quinazolin-4-amine (PubChem CID 64983638) has the molecular formula C11H8F5N3 and a molecular weight of 277.20 g/mol. Its IUPAC name is 8-methyl-2-(1,1,2,2,2-pentafluoroethyl)quinazolin-4-amine.
| Compound Name | 8-methyl-2-(1,1,2,2,2-pentafluoroethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 64983638 |
| Molecular Formula | C11H8F5N3 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 8-methyl-2-(1,1,2,2,2-pentafluoroethyl)quinazolin-4-amine |
| SMILES | Cc1cccc2c(N)nc(C(F)(F)C(F)(F)F)nc12 |
| InChI | InChI=1S/C11H8F5N3/c1-5-3-2-4-6-7(5)18-9(19-8(6)17)10(12,13)11(14,15)16/h2-4H,1H3,(H2,17,18,19) |
| InChIKey | YADGMHXUTQZQPB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|