C14H17N5O2S — CID 6498420
[5-amino-1-(3-methylsulfanylphenyl)triazol-4-yl]-morpholin-4-ylmethanone (PubChem CID 6498420) has the molecular formula C14H17N5O2S and a molecular weight of 319.39 g/mol. Its IUPAC name is [5-amino-1-(3-methylsulfanylphenyl)triazol-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [5-amino-1-(3-methylsulfanylphenyl)triazol-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 6498420 |
| Molecular Formula | C14H17N5O2S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | [5-amino-1-(3-methylsulfanylphenyl)triazol-4-yl]-morpholin-4-ylmethanone |
| SMILES | CSc1cccc(-n2nnc(C(=O)N3CCOCC3)c2N)c1 |
| InChI | InChI=1S/C14H17N5O2S/c1-22-11-4-2-3-10(9-11)19-13(15)12(16-17-19)14(20)18-5-7-21-8-6-18/h2-4,9H,5-8,15H2,1H3 |
| InChIKey | JWSNIAYVRJIELH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |