C15H24O — CID 64984866
3-methyl-2-(2,4,5-trimethylphenyl)pentan-2-ol (PubChem CID 64984866) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 3-methyl-2-(2,4,5-trimethylphenyl)pentan-2-ol.
| Compound Name | 3-methyl-2-(2,4,5-trimethylphenyl)pentan-2-ol |
|---|---|
| PubChem CID | 64984866 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 3-methyl-2-(2,4,5-trimethylphenyl)pentan-2-ol |
| SMILES | CCC(C)C(C)(O)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C15H24O/c1-7-13(5)15(6,16)14-9-11(3)10(2)8-12(14)4/h8-9,13,16H,7H2,1-6H3 |
| InChIKey | KRSZJDJPVSPNAJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |