About [5-(furan-2-yl)-1,3-oxazol-2-yl]methanamine
[5-(furan-2-yl)-1,3-oxazol-2-yl]methanamine (PubChem CID 64985073) has the molecular formula C8H8N2O2
and a molecular weight of 164.16 g/mol. Its IUPAC name is [5-(furan-2-yl)-1,3-oxazol-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-(furan-2-yl)-1,3-oxazol-2-yl]methanamine |
| PubChem CID | 64985073 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | [5-(furan-2-yl)-1,3-oxazol-2-yl]methanamine |
| SMILES | NCc1ncc(-c2ccco2)o1 |
| InChI | InChI=1S/C8H8N2O2/c9-4-8-10-5-7(12-8)6-2-1-3-11-6/h1-3,5H,4,9H2 |
| InChIKey | PZQRUCSHEXKYPI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(furan-2-yl)-1,3-oxazol-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(furan-2-yl)-1,3-oxazol-2-yl]methanamine?
The IUPAC name of [5-(furan-2-yl)-1,3-oxazol-2-yl]methanamine (CID 64985073) is [5-(furan-2-yl)-1,3-oxazol-2-yl]methanamine.
What is the SMILES notation for [5-(furan-2-yl)-1,3-oxazol-2-yl]methanamine?
The canonical SMILES for [5-(furan-2-yl)-1,3-oxazol-2-yl]methanamine is NCc1ncc(-c2ccco2)o1.
What is the InChIKey of [5-(furan-2-yl)-1,3-oxazol-2-yl]methanamine?
The InChIKey is PZQRUCSHEXKYPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2/c9-4-8-10-5-7(12-8)6-2-1-3-11-6/h1-3,5H,4,9H2.
What are the key properties of [5-(furan-2-yl)-1,3-oxazol-2-yl]methanamine?
[5-(furan-2-yl)-1,3-oxazol-2-yl]methanamine has a molecular weight of 164.16 g/mol, XLogP of 1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(furan-2-yl)-1,3-oxazol-2-yl]methanamine is sourced from PubChem (CID 64985073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).