C16H19N — CID 64985236
[3-(2,4,5-trimethylphenyl)phenyl]methanamine (PubChem CID 64985236) has the molecular formula C16H19N and a molecular weight of 225.33 g/mol. Its IUPAC name is [3-(2,4,5-trimethylphenyl)phenyl]methanamine.
| Compound Name | [3-(2,4,5-trimethylphenyl)phenyl]methanamine |
|---|---|
| PubChem CID | 64985236 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | [3-(2,4,5-trimethylphenyl)phenyl]methanamine |
| SMILES | Cc1cc(C)c(-c2cccc(CN)c2)cc1C |
| InChI | InChI=1S/C16H19N/c1-11-7-13(3)16(8-12(11)2)15-6-4-5-14(9-15)10-17/h4-9H,10,17H2,1-3H3 |
| InChIKey | AFRZYTFJUUJXJJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |