C15H16N4 — CID 64986048
[2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine (PubChem CID 64986048) has the molecular formula C15H16N4 and a molecular weight of 252.32 g/mol. Its IUPAC name is [2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 64986048 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | [2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(C2Cc3ccccc32)nc2c1CCC2 |
| InChI | InChI=1S/C15H16N4/c16-19-15-11-6-3-7-13(11)17-14(18-15)12-8-9-4-1-2-5-10(9)12/h1-2,4-5,12H,3,6-8,16H2,(H,17,18,19) |
| InChIKey | MKLGVAWYCHKORI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|