About 1-cyclopropyl-N-(2,2-dimethoxyethyl)methanesulfonamide
1-cyclopropyl-N-(2,2-dimethoxyethyl)methanesulfonamide (PubChem CID 64987276) has the molecular formula C8H17NO4S
and a molecular weight of 223.29 g/mol. Its IUPAC name is 1-cyclopropyl-N-(2,2-dimethoxyethyl)methanesulfonamide.
Molecular Properties
| Compound Name | 1-cyclopropyl-N-(2,2-dimethoxyethyl)methanesulfonamide |
| PubChem CID | 64987276 |
| Molecular Formula | C8H17NO4S |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 1-cyclopropyl-N-(2,2-dimethoxyethyl)methanesulfonamide |
| SMILES | COC(CNS(=O)(=O)CC1CC1)OC |
| InChI | InChI=1S/C8H17NO4S/c1-12-8(13-2)5-9-14(10,11)6-7-3-4-7/h7-9H,3-6H2,1-2H3 |
| InChIKey | RBHDSIBYAIJZOS-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopropyl-N-(2,2-dimethoxyethyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-N-(2,2-dimethoxyethyl)methanesulfonamide?
The IUPAC name of 1-cyclopropyl-N-(2,2-dimethoxyethyl)methanesulfonamide (CID 64987276) is 1-cyclopropyl-N-(2,2-dimethoxyethyl)methanesulfonamide.
What is the SMILES notation for 1-cyclopropyl-N-(2,2-dimethoxyethyl)methanesulfonamide?
The canonical SMILES for 1-cyclopropyl-N-(2,2-dimethoxyethyl)methanesulfonamide is COC(CNS(=O)(=O)CC1CC1)OC.
What is the InChIKey of 1-cyclopropyl-N-(2,2-dimethoxyethyl)methanesulfonamide?
The InChIKey is RBHDSIBYAIJZOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO4S/c1-12-8(13-2)5-9-14(10,11)6-7-3-4-7/h7-9H,3-6H2,1-2H3.
What are the key properties of 1-cyclopropyl-N-(2,2-dimethoxyethyl)methanesulfonamide?
1-cyclopropyl-N-(2,2-dimethoxyethyl)methanesulfonamide has a molecular weight of 223.29 g/mol, XLogP of -0.07, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-N-(2,2-dimethoxyethyl)methanesulfonamide is sourced from PubChem (CID 64987276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).