C13H17N5O2 — CID 649892
6-ethoxy-2-N-(furan-2-ylmethyl)-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine (PubChem CID 649892) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 6-ethoxy-2-N-(furan-2-ylmethyl)-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-ethoxy-2-N-(furan-2-ylmethyl)-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 649892 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 6-ethoxy-2-N-(furan-2-ylmethyl)-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCNc1nc(NCc2ccco2)nc(OCC)n1 |
| InChI | InChI=1S/C13H17N5O2/c1-3-7-14-11-16-12(18-13(17-11)19-4-2)15-9-10-6-5-8-20-10/h3,5-6,8H,1,4,7,9H2,2H3,(H2,14,15,16,17,18) |
| InChIKey | GEDHZAQXEAFMRB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|