C17H18F3N — CID 64990056
N-methyl-1-(3,4,5-trifluorophenyl)-1-(2,4,5-trimethylphenyl)methanamine (PubChem CID 64990056) has the molecular formula C17H18F3N and a molecular weight of 293.33 g/mol. Its IUPAC name is N-methyl-1-(3,4,5-trifluorophenyl)-1-(2,4,5-trimethylphenyl)methanamine.
| Compound Name | N-methyl-1-(3,4,5-trifluorophenyl)-1-(2,4,5-trimethylphenyl)methanamine |
|---|---|
| PubChem CID | 64990056 |
| Molecular Formula | C17H18F3N |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | N-methyl-1-(3,4,5-trifluorophenyl)-1-(2,4,5-trimethylphenyl)methanamine |
| SMILES | CNC(c1cc(F)c(F)c(F)c1)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C17H18F3N/c1-9-5-11(3)13(6-10(9)2)17(21-4)12-7-14(18)16(20)15(19)8-12/h5-8,17,21H,1-4H3 |
| InChIKey | RTEPVQICFILVHM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|