C10H12N2O3 — CID 64990664
N-(4-formamido-2-methoxyphenyl)acetamide (PubChem CID 64990664) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is N-(4-formamido-2-methoxyphenyl)acetamide.
| Compound Name | N-(4-formamido-2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 64990664 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | N-(4-formamido-2-methoxyphenyl)acetamide |
| SMILES | COc1cc(NC=O)ccc1NC(C)=O |
| InChI | InChI=1S/C10H12N2O3/c1-7(14)12-9-4-3-8(11-6-13)5-10(9)15-2/h3-6H,1-2H3,(H,11,13)(H,12,14) |
| InChIKey | AUDGEGNCOCKUSZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|