C10H16N2O2S — CID 64990979
2-(2-methylpropylamino)-2-(1,3-thiazol-2-yl)propanoic acid (PubChem CID 64990979) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-(2-methylpropylamino)-2-(1,3-thiazol-2-yl)propanoic acid.
| Compound Name | 2-(2-methylpropylamino)-2-(1,3-thiazol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 64990979 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-(2-methylpropylamino)-2-(1,3-thiazol-2-yl)propanoic acid |
| SMILES | CC(C)CNC(C)(C(=O)O)c1nccs1 |
| InChI | InChI=1S/C10H16N2O2S/c1-7(2)6-12-10(3,9(13)14)8-11-4-5-15-8/h4-5,7,12H,6H2,1-3H3,(H,13,14) |
| InChIKey | ZNWBDJUQULBFLQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |