C9H11NO3S — CID 64992052
N-[(4-methylsulfonylphenyl)methyl]formamide (PubChem CID 64992052) has the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. Its IUPAC name is N-[(4-methylsulfonylphenyl)methyl]formamide.
| Compound Name | N-[(4-methylsulfonylphenyl)methyl]formamide |
|---|---|
| PubChem CID | 64992052 |
| Molecular Formula | C9H11NO3S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | N-[(4-methylsulfonylphenyl)methyl]formamide |
| SMILES | CS(=O)(=O)c1ccc(CNC=O)cc1 |
| InChI | InChI=1S/C9H11NO3S/c1-14(12,13)9-4-2-8(3-5-9)6-10-7-11/h2-5,7H,6H2,1H3,(H,10,11) |
| InChIKey | APADBYZAINSRCR-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|