C8H14N2O — CID 64992652
N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)formamide (PubChem CID 64992652) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)formamide.
| Compound Name | N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)formamide |
|---|---|
| PubChem CID | 64992652 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)formamide |
| SMILES | O=CNC1CCN2CCCC12 |
| InChI | InChI=1S/C8H14N2O/c11-6-9-7-3-5-10-4-1-2-8(7)10/h6-8H,1-5H2,(H,9,11) |
| InChIKey | NLHGIYWRKRLILI-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|