About 3-methyl-3-(1,3-thiazol-2-yl)oxolane-2,5-dione
3-methyl-3-(1,3-thiazol-2-yl)oxolane-2,5-dione (PubChem CID 64992965) has the molecular formula C8H7NO3S
and a molecular weight of 197.22 g/mol. Its IUPAC name is 3-methyl-3-(1,3-thiazol-2-yl)oxolane-2,5-dione.
Molecular Properties
| Compound Name | 3-methyl-3-(1,3-thiazol-2-yl)oxolane-2,5-dione |
| PubChem CID | 64992965 |
| Molecular Formula | C8H7NO3S |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | 3-methyl-3-(1,3-thiazol-2-yl)oxolane-2,5-dione |
| SMILES | CC1(c2nccs2)CC(=O)OC1=O |
| InChI | InChI=1S/C8H7NO3S/c1-8(6-9-2-3-13-6)4-5(10)12-7(8)11/h2-3H,4H2,1H3 |
| InChIKey | FVHJBAHFCGRXCA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-3-(1,3-thiazol-2-yl)oxolane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3-(1,3-thiazol-2-yl)oxolane-2,5-dione?
The IUPAC name of 3-methyl-3-(1,3-thiazol-2-yl)oxolane-2,5-dione (CID 64992965) is 3-methyl-3-(1,3-thiazol-2-yl)oxolane-2,5-dione.
What is the SMILES notation for 3-methyl-3-(1,3-thiazol-2-yl)oxolane-2,5-dione?
The canonical SMILES for 3-methyl-3-(1,3-thiazol-2-yl)oxolane-2,5-dione is CC1(c2nccs2)CC(=O)OC1=O.
What is the InChIKey of 3-methyl-3-(1,3-thiazol-2-yl)oxolane-2,5-dione?
The InChIKey is FVHJBAHFCGRXCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3S/c1-8(6-9-2-3-13-6)4-5(10)12-7(8)11/h2-3H,4H2,1H3.
What are the key properties of 3-methyl-3-(1,3-thiazol-2-yl)oxolane-2,5-dione?
3-methyl-3-(1,3-thiazol-2-yl)oxolane-2,5-dione has a molecular weight of 197.22 g/mol, XLogP of 0.87, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3-(1,3-thiazol-2-yl)oxolane-2,5-dione is sourced from PubChem (CID 64992965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).