About N-ethyl-5-(1,3-thiazol-2-yl)-1H-pyrazol-3-amine
N-ethyl-5-(1,3-thiazol-2-yl)-1H-pyrazol-3-amine (PubChem CID 64993636) has the molecular formula C8H10N4S
and a molecular weight of 194.26 g/mol. Its IUPAC name is N-ethyl-5-(1,3-thiazol-2-yl)-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | N-ethyl-5-(1,3-thiazol-2-yl)-1H-pyrazol-3-amine |
| PubChem CID | 64993636 |
| Molecular Formula | C8H10N4S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | N-ethyl-5-(1,3-thiazol-2-yl)-1H-pyrazol-3-amine |
| SMILES | CCNc1cc(-c2nccs2)[nH]n1 |
| InChI | InChI=1S/C8H10N4S/c1-2-9-7-5-6(11-12-7)8-10-3-4-13-8/h3-5H,2H2,1H3,(H2,9,11,12) |
| InChIKey | WOEWZBKVBNHAEP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-5-(1,3-thiazol-2-yl)-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-5-(1,3-thiazol-2-yl)-1H-pyrazol-3-amine?
The IUPAC name of N-ethyl-5-(1,3-thiazol-2-yl)-1H-pyrazol-3-amine (CID 64993636) is N-ethyl-5-(1,3-thiazol-2-yl)-1H-pyrazol-3-amine.
What is the SMILES notation for N-ethyl-5-(1,3-thiazol-2-yl)-1H-pyrazol-3-amine?
The canonical SMILES for N-ethyl-5-(1,3-thiazol-2-yl)-1H-pyrazol-3-amine is CCNc1cc(-c2nccs2)[nH]n1.
What is the InChIKey of N-ethyl-5-(1,3-thiazol-2-yl)-1H-pyrazol-3-amine?
The InChIKey is WOEWZBKVBNHAEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4S/c1-2-9-7-5-6(11-12-7)8-10-3-4-13-8/h3-5H,2H2,1H3,(H2,9,11,12).
What are the key properties of N-ethyl-5-(1,3-thiazol-2-yl)-1H-pyrazol-3-amine?
N-ethyl-5-(1,3-thiazol-2-yl)-1H-pyrazol-3-amine has a molecular weight of 194.26 g/mol, XLogP of 1.97, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-5-(1,3-thiazol-2-yl)-1H-pyrazol-3-amine is sourced from PubChem (CID 64993636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).