About 10-(3-bromo-2,2-dimethylpropyl)acridin-9-one
10-(3-bromo-2,2-dimethylpropyl)acridin-9-one (PubChem CID 64994942) has the molecular formula C18H18BrNO
and a molecular weight of 344.25 g/mol. Its IUPAC name is 10-(3-bromo-2,2-dimethylpropyl)acridin-9-one.
Molecular Properties
| Compound Name | 10-(3-bromo-2,2-dimethylpropyl)acridin-9-one |
| PubChem CID | 64994942 |
| Molecular Formula | C18H18BrNO |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 10-(3-bromo-2,2-dimethylpropyl)acridin-9-one |
| SMILES | CC(C)(CBr)Cn1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C18H18BrNO/c1-18(2,11-19)12-20-15-9-5-3-7-13(15)17(21)14-8-4-6-10-16(14)20/h3-10H,11-12H2,1-2H3 |
| InChIKey | IIALAVJJMCUQCG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 10-(3-bromo-2,2-dimethylpropyl)acridin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(3-bromo-2,2-dimethylpropyl)acridin-9-one?
The IUPAC name of 10-(3-bromo-2,2-dimethylpropyl)acridin-9-one (CID 64994942) is 10-(3-bromo-2,2-dimethylpropyl)acridin-9-one.
What is the SMILES notation for 10-(3-bromo-2,2-dimethylpropyl)acridin-9-one?
The canonical SMILES for 10-(3-bromo-2,2-dimethylpropyl)acridin-9-one is CC(C)(CBr)Cn1c2ccccc2c(=O)c2ccccc21.
What is the InChIKey of 10-(3-bromo-2,2-dimethylpropyl)acridin-9-one?
The InChIKey is IIALAVJJMCUQCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18BrNO/c1-18(2,11-19)12-20-15-9-5-3-7-13(15)17(21)14-8-4-6-10-16(14)20/h3-10H,11-12H2,1-2H3.
What are the key properties of 10-(3-bromo-2,2-dimethylpropyl)acridin-9-one?
10-(3-bromo-2,2-dimethylpropyl)acridin-9-one has a molecular weight of 344.25 g/mol, XLogP of 4.58, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(3-bromo-2,2-dimethylpropyl)acridin-9-one is sourced from PubChem (CID 64994942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).