About 1-(3-bromo-2,2-dimethylpropyl)-5,6-dimethylbenzimidazole
1-(3-bromo-2,2-dimethylpropyl)-5,6-dimethylbenzimidazole (PubChem CID 64995120) has the molecular formula C14H19BrN2
and a molecular weight of 295.22 g/mol. Its IUPAC name is 1-(3-bromo-2,2-dimethylpropyl)-5,6-dimethylbenzimidazole.
Molecular Properties
| Compound Name | 1-(3-bromo-2,2-dimethylpropyl)-5,6-dimethylbenzimidazole |
| PubChem CID | 64995120 |
| Molecular Formula | C14H19BrN2 |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 1-(3-bromo-2,2-dimethylpropyl)-5,6-dimethylbenzimidazole |
| SMILES | Cc1cc2ncn(CC(C)(C)CBr)c2cc1C |
| InChI | InChI=1S/C14H19BrN2/c1-10-5-12-13(6-11(10)2)17(9-16-12)8-14(3,4)7-15/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | HNNPCADYPWYTTI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-bromo-2,2-dimethylpropyl)-5,6-dimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromo-2,2-dimethylpropyl)-5,6-dimethylbenzimidazole?
The IUPAC name of 1-(3-bromo-2,2-dimethylpropyl)-5,6-dimethylbenzimidazole (CID 64995120) is 1-(3-bromo-2,2-dimethylpropyl)-5,6-dimethylbenzimidazole.
What is the SMILES notation for 1-(3-bromo-2,2-dimethylpropyl)-5,6-dimethylbenzimidazole?
The canonical SMILES for 1-(3-bromo-2,2-dimethylpropyl)-5,6-dimethylbenzimidazole is Cc1cc2ncn(CC(C)(C)CBr)c2cc1C.
What is the InChIKey of 1-(3-bromo-2,2-dimethylpropyl)-5,6-dimethylbenzimidazole?
The InChIKey is HNNPCADYPWYTTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BrN2/c1-10-5-12-13(6-11(10)2)17(9-16-12)8-14(3,4)7-15/h5-6,9H,7-8H2,1-4H3.
What are the key properties of 1-(3-bromo-2,2-dimethylpropyl)-5,6-dimethylbenzimidazole?
1-(3-bromo-2,2-dimethylpropyl)-5,6-dimethylbenzimidazole has a molecular weight of 295.22 g/mol, XLogP of 4.07, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromo-2,2-dimethylpropyl)-5,6-dimethylbenzimidazole is sourced from PubChem (CID 64995120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).