C12H16Br2O — CID 64995276
2-bromo-1-(3-bromo-2,2-dimethylpropoxy)-4-methylbenzene (PubChem CID 64995276) has the molecular formula C12H16Br2O and a molecular weight of 336.07 g/mol. Its IUPAC name is 2-bromo-1-(3-bromo-2,2-dimethylpropoxy)-4-methylbenzene.
| Compound Name | 2-bromo-1-(3-bromo-2,2-dimethylpropoxy)-4-methylbenzene |
|---|---|
| PubChem CID | 64995276 |
| Molecular Formula | C12H16Br2O |
| Molecular Weight | 336.07 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | 2-bromo-1-(3-bromo-2,2-dimethylpropoxy)-4-methylbenzene |
| SMILES | Cc1ccc(OCC(C)(C)CBr)c(Br)c1 |
| InChI | InChI=1S/C12H16Br2O/c1-9-4-5-11(10(14)6-9)15-8-12(2,3)7-13/h4-6H,7-8H2,1-3H3 |
| InChIKey | DZKFEUZBPFBAGR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.07 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|