About 3-(3-bromo-2-methylpropyl)sulfanyl-4-methyl-1,2,4-triazole
3-(3-bromo-2-methylpropyl)sulfanyl-4-methyl-1,2,4-triazole (PubChem CID 64995898) has the molecular formula C7H12BrN3S
and a molecular weight of 250.16 g/mol. Its IUPAC name is 3-(3-bromo-2-methylpropyl)sulfanyl-4-methyl-1,2,4-triazole.
Molecular Properties
| Compound Name | 3-(3-bromo-2-methylpropyl)sulfanyl-4-methyl-1,2,4-triazole |
| PubChem CID | 64995898 |
| Molecular Formula | C7H12BrN3S |
| Molecular Weight | 250.16 g/mol |
| Exact Mass | 248.99 |
| IUPAC Name | 3-(3-bromo-2-methylpropyl)sulfanyl-4-methyl-1,2,4-triazole |
| SMILES | CC(CBr)CSc1nncn1C |
| InChI | InChI=1S/C7H12BrN3S/c1-6(3-8)4-12-7-10-9-5-11(7)2/h5-6H,3-4H2,1-2H3 |
| InChIKey | IOHOSJWTPWYGIJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.16 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-bromo-2-methylpropyl)sulfanyl-4-methyl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-bromo-2-methylpropyl)sulfanyl-4-methyl-1,2,4-triazole?
The IUPAC name of 3-(3-bromo-2-methylpropyl)sulfanyl-4-methyl-1,2,4-triazole (CID 64995898) is 3-(3-bromo-2-methylpropyl)sulfanyl-4-methyl-1,2,4-triazole.
What is the SMILES notation for 3-(3-bromo-2-methylpropyl)sulfanyl-4-methyl-1,2,4-triazole?
The canonical SMILES for 3-(3-bromo-2-methylpropyl)sulfanyl-4-methyl-1,2,4-triazole is CC(CBr)CSc1nncn1C.
What is the InChIKey of 3-(3-bromo-2-methylpropyl)sulfanyl-4-methyl-1,2,4-triazole?
The InChIKey is IOHOSJWTPWYGIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12BrN3S/c1-6(3-8)4-12-7-10-9-5-11(7)2/h5-6H,3-4H2,1-2H3.
What are the key properties of 3-(3-bromo-2-methylpropyl)sulfanyl-4-methyl-1,2,4-triazole?
3-(3-bromo-2-methylpropyl)sulfanyl-4-methyl-1,2,4-triazole has a molecular weight of 250.16 g/mol, XLogP of 1.94, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromo-2-methylpropyl)sulfanyl-4-methyl-1,2,4-triazole is sourced from PubChem (CID 64995898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).