About (4-chlorophenyl) 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate
(4-chlorophenyl) 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate (PubChem CID 6499809) has the molecular formula C13H12Cl2N2O2
and a molecular weight of 299.16 g/mol. Its IUPAC name is (4-chlorophenyl) 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate.
Molecular Properties
| Compound Name | (4-chlorophenyl) 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate |
| PubChem CID | 6499809 |
| Molecular Formula | C13H12Cl2N2O2 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | (4-chlorophenyl) 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate |
| SMILES | Cc1nn(CC(=O)Oc2ccc(Cl)cc2)c(C)c1Cl |
| InChI | InChI=1S/C13H12Cl2N2O2/c1-8-13(15)9(2)17(16-8)7-12(18)19-11-5-3-10(14)4-6-11/h3-6H,7H2,1-2H3 |
| InChIKey | MTNDRUQCAZGJFN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl) 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl) 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate?
The IUPAC name of (4-chlorophenyl) 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate (CID 6499809) is (4-chlorophenyl) 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate.
What is the SMILES notation for (4-chlorophenyl) 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate?
The canonical SMILES for (4-chlorophenyl) 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate is Cc1nn(CC(=O)Oc2ccc(Cl)cc2)c(C)c1Cl.
What is the InChIKey of (4-chlorophenyl) 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate?
The InChIKey is MTNDRUQCAZGJFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Cl2N2O2/c1-8-13(15)9(2)17(16-8)7-12(18)19-11-5-3-10(14)4-6-11/h3-6H,7H2,1-2H3.
What are the key properties of (4-chlorophenyl) 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate?
(4-chlorophenyl) 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate has a molecular weight of 299.16 g/mol, XLogP of 3.41, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl) 2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetate is sourced from PubChem (CID 6499809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).