C14H18N4O — CID 6499834
N-[2-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]benzamide (PubChem CID 6499834) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is N-[2-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]benzamide.
| Compound Name | N-[2-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 6499834 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N-[2-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]benzamide |
| SMILES | Cc1nc(C)n(C(C)CNC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C14H18N4O/c1-10(18-12(3)16-11(2)17-18)9-15-14(19)13-7-5-4-6-8-13/h4-8,10H,9H2,1-3H3,(H,15,19) |
| InChIKey | WDPIQKMDHUNVDP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |