About 4-methyl-N-[2-(1,2,4-triazol-1-yl)propyl]benzenesulfonamide
4-methyl-N-[2-(1,2,4-triazol-1-yl)propyl]benzenesulfonamide (PubChem CID 6499838) has the molecular formula C12H16N4O2S
and a molecular weight of 280.35 g/mol. Its IUPAC name is 4-methyl-N-[2-(1,2,4-triazol-1-yl)propyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-methyl-N-[2-(1,2,4-triazol-1-yl)propyl]benzenesulfonamide |
| PubChem CID | 6499838 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 4-methyl-N-[2-(1,2,4-triazol-1-yl)propyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(C)n2cncn2)cc1 |
| InChI | InChI=1S/C12H16N4O2S/c1-10-3-5-12(6-4-10)19(17,18)15-7-11(2)16-9-13-8-14-16/h3-6,8-9,11,15H,7H2,1-2H3 |
| InChIKey | SNVGCELTMPKLFN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methyl-N-[2-(1,2,4-triazol-1-yl)propyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-[2-(1,2,4-triazol-1-yl)propyl]benzenesulfonamide?
The IUPAC name of 4-methyl-N-[2-(1,2,4-triazol-1-yl)propyl]benzenesulfonamide (CID 6499838) is 4-methyl-N-[2-(1,2,4-triazol-1-yl)propyl]benzenesulfonamide.
What is the SMILES notation for 4-methyl-N-[2-(1,2,4-triazol-1-yl)propyl]benzenesulfonamide?
The canonical SMILES for 4-methyl-N-[2-(1,2,4-triazol-1-yl)propyl]benzenesulfonamide is Cc1ccc(S(=O)(=O)NCC(C)n2cncn2)cc1.
What is the InChIKey of 4-methyl-N-[2-(1,2,4-triazol-1-yl)propyl]benzenesulfonamide?
The InChIKey is SNVGCELTMPKLFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O2S/c1-10-3-5-12(6-4-10)19(17,18)15-7-11(2)16-9-13-8-14-16/h3-6,8-9,11,15H,7H2,1-2H3.
What are the key properties of 4-methyl-N-[2-(1,2,4-triazol-1-yl)propyl]benzenesulfonamide?
4-methyl-N-[2-(1,2,4-triazol-1-yl)propyl]benzenesulfonamide has a molecular weight of 280.35 g/mol, XLogP of 1.13, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-[2-(1,2,4-triazol-1-yl)propyl]benzenesulfonamide is sourced from PubChem (CID 6499838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).